C20H26N4O2S2 — CID 56836305
3-(N'-phenylcarbamimidoyl)sulfanylpropyl N'-[4-(2-methoxyethoxy)phenyl]carbamimidothioate (PubChem CID 56836305) has the molecular formula C20H26N4O2S2 and a molecular weight of 418.59 g/mol. Its IUPAC name is 3-(N'-phenylcarbamimidoyl)sulfanylpropyl N'-[4-(2-methoxyethoxy)phenyl]carbamimidothioate.
| Compound Name | 3-(N'-phenylcarbamimidoyl)sulfanylpropyl N'-[4-(2-methoxyethoxy)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 56836305 |
| Molecular Formula | C20H26N4O2S2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-(N'-phenylcarbamimidoyl)sulfanylpropyl N'-[4-(2-methoxyethoxy)phenyl]carbamimidothioate |
| SMILES | COCCOc1ccc(/N=C(/N)SCCCS/C(N)=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N4O2S2/c1-25-12-13-26-18-10-8-17(9-11-18)24-20(22)28-15-5-14-27-19(21)23-16-6-3-2-4-7-16/h2-4,6-11H,5,12-15H2,1H3,(H2,21,23)(H2,22,24) |
| InChIKey | NECYYQJKZUYOKD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|