C16H17FN2O2S — CID 8776447
2-(4-fluorophenoxy)ethyl N'-(3-methoxyphenyl)carbamimidothioate (PubChem CID 8776447) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl N'-(3-methoxyphenyl)carbamimidothioate.
| Compound Name | 2-(4-fluorophenoxy)ethyl N'-(3-methoxyphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 8776447 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl N'-(3-methoxyphenyl)carbamimidothioate |
| SMILES | COc1cccc(/N=C(/N)SCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H17FN2O2S/c1-20-15-4-2-3-13(11-15)19-16(18)22-10-9-21-14-7-5-12(17)6-8-14/h2-8,11H,9-10H2,1H3,(H2,18,19) |
| InChIKey | BHOMWXGGHNRFQA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|