About 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate
2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate (PubChem CID 8774947) has the molecular formula C12H18N2O2S
and a molecular weight of 254.36 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate.
Molecular Properties
| Compound Name | 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate |
| PubChem CID | 8774947 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate |
| SMILES | CC/N=C(\N)SCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C12H18N2O2S/c1-3-14-12(13)17-9-8-16-11-6-4-10(15-2)5-7-11/h4-7H,3,8-9H2,1-2H3,(H2,13,14) |
| InChIKey | DADKOUQEGNTUQW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate?
The IUPAC name of 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate (CID 8774947) is 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate.
What is the SMILES notation for 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate?
The canonical SMILES for 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate is CC/N=C(\N)SCCOc1ccc(OC)cc1.
What is the InChIKey of 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate?
The InChIKey is DADKOUQEGNTUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2S/c1-3-14-12(13)17-9-8-16-11-6-4-10(15-2)5-7-11/h4-7H,3,8-9H2,1-2H3,(H2,13,14).
What are the key properties of 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate?
2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate has a molecular weight of 254.36 g/mol, XLogP of 2.14, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenoxy)ethyl N'-ethylcarbamimidothioate is sourced from PubChem (CID 8774947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).