About 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate
2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate (PubChem CID 8776606) has the molecular formula C15H24N2O2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate |
| PubChem CID | 8776606 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate |
| SMILES | CCOc1ccc(OCCS/C(N)=N/C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24N2O2S/c1-5-18-12-6-8-13(9-7-12)19-10-11-20-14(16)17-15(2,3)4/h6-9H,5,10-11H2,1-4H3,(H2,16,17) |
| InChIKey | KXTSVYYOEFHZAP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate?
The IUPAC name of 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate (CID 8776606) is 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate.
What is the SMILES notation for 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate?
The canonical SMILES for 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate is CCOc1ccc(OCCS/C(N)=N/C(C)(C)C)cc1.
What is the InChIKey of 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate?
The InChIKey is KXTSVYYOEFHZAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2S/c1-5-18-12-6-8-13(9-7-12)19-10-11-20-14(16)17-15(2,3)4/h6-9H,5,10-11H2,1-4H3,(H2,16,17).
What are the key properties of 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate?
2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate has a molecular weight of 296.44 g/mol, XLogP of 3.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenoxy)ethyl N'-tert-butylcarbamimidothioate is sourced from PubChem (CID 8776606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).