About 2-(4-methylphenoxy)ethyl carbamodithioate
2-(4-methylphenoxy)ethyl carbamodithioate (PubChem CID 2294136) has the molecular formula C10H13NOS2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl carbamodithioate.
Molecular Properties
| Compound Name | 2-(4-methylphenoxy)ethyl carbamodithioate |
| PubChem CID | 2294136 |
| Molecular Formula | C10H13NOS2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl carbamodithioate |
| SMILES | Cc1ccc(OCCSC(N)=S)cc1 |
| InChI | InChI=1S/C10H13NOS2/c1-8-2-4-9(5-3-8)12-6-7-14-10(11)13/h2-5H,6-7H2,1H3,(H2,11,13) |
| InChIKey | TUOICYKSWXAWKQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenoxy)ethyl carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenoxy)ethyl carbamodithioate?
The IUPAC name of 2-(4-methylphenoxy)ethyl carbamodithioate (CID 2294136) is 2-(4-methylphenoxy)ethyl carbamodithioate.
What is the SMILES notation for 2-(4-methylphenoxy)ethyl carbamodithioate?
The canonical SMILES for 2-(4-methylphenoxy)ethyl carbamodithioate is Cc1ccc(OCCSC(N)=S)cc1.
What is the InChIKey of 2-(4-methylphenoxy)ethyl carbamodithioate?
The InChIKey is TUOICYKSWXAWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NOS2/c1-8-2-4-9(5-3-8)12-6-7-14-10(11)13/h2-5H,6-7H2,1H3,(H2,11,13).
What are the key properties of 2-(4-methylphenoxy)ethyl carbamodithioate?
2-(4-methylphenoxy)ethyl carbamodithioate has a molecular weight of 227.35 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenoxy)ethyl carbamodithioate is sourced from PubChem (CID 2294136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).