C18H22N2OS — CID 8776659
2-(4-methylphenoxy)ethyl N'-(3,4-dimethylphenyl)carbamimidothioate (PubChem CID 8776659) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl N'-(3,4-dimethylphenyl)carbamimidothioate.
| Compound Name | 2-(4-methylphenoxy)ethyl N'-(3,4-dimethylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 8776659 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl N'-(3,4-dimethylphenyl)carbamimidothioate |
| SMILES | Cc1ccc(OCCS/C(N)=N\c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H22N2OS/c1-13-4-8-17(9-5-13)21-10-11-22-18(19)20-16-7-6-14(2)15(3)12-16/h4-9,12H,10-11H2,1-3H3,(H2,19,20) |
| InChIKey | MGHPQSCRAWTQBH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|