C17H20ClN3OS — CID 71899863
(4-carbamoylphenyl)methyl N'-(3,4-dimethylphenyl)carbamimidothioate;hydrochloride (PubChem CID 71899863) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is (4-carbamoylphenyl)methyl N'-(3,4-dimethylphenyl)carbamimidothioate;hydrochloride.
| Compound Name | (4-carbamoylphenyl)methyl N'-(3,4-dimethylphenyl)carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 71899863 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (4-carbamoylphenyl)methyl N'-(3,4-dimethylphenyl)carbamimidothioate;hydrochloride |
| SMILES | Cc1ccc(/N=C(\N)SCc2ccc(C(N)=O)cc2)cc1C.Cl |
| InChI | InChI=1S/C17H19N3OS.ClH/c1-11-3-8-15(9-12(11)2)20-17(19)22-10-13-4-6-14(7-5-13)16(18)21;/h3-9H,10H2,1-2H3,(H2,18,21)(H2,19,20);1H |
| InChIKey | HZJJZUYZKPYLPH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|