C17H20N2S2 — CID 8775499
(4-methylsulfanylphenyl)methyl N'-(3,5-dimethylphenyl)carbamimidothioate (PubChem CID 8775499) has the molecular formula C17H20N2S2 and a molecular weight of 316.50 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl N'-(3,5-dimethylphenyl)carbamimidothioate.
| Compound Name | (4-methylsulfanylphenyl)methyl N'-(3,5-dimethylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 8775499 |
| Molecular Formula | C17H20N2S2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl N'-(3,5-dimethylphenyl)carbamimidothioate |
| SMILES | CSc1ccc(CS/C(N)=N/c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C17H20N2S2/c1-12-8-13(2)10-15(9-12)19-17(18)21-11-14-4-6-16(20-3)7-5-14/h4-10H,11H2,1-3H3,(H2,18,19) |
| InChIKey | JZTDXRFHGIBYSK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|