C13H20N2OS2 — CID 8775875
(4-methylsulfanylphenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate (PubChem CID 8775875) has the molecular formula C13H20N2OS2 and a molecular weight of 284.45 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate.
| Compound Name | (4-methylsulfanylphenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate |
|---|---|
| PubChem CID | 8775875 |
| Molecular Formula | C13H20N2OS2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate |
| SMILES | COC[C@H](C)/N=C(\N)SCc1ccc(SC)cc1 |
| InChI | InChI=1S/C13H20N2OS2/c1-10(8-16-2)15-13(14)18-9-11-4-6-12(17-3)7-5-11/h4-7,10H,8-9H2,1-3H3,(H2,14,15)/t10-/m0/s1 |
| InChIKey | WCJDUHNFPGZNLL-JTQLQIEISA-N |
| XLogP | 2.99 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|