C18H30N2OS — CID 8775883
(4-tert-butyl-2,6-dimethylphenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate (PubChem CID 8775883) has the molecular formula C18H30N2OS and a molecular weight of 322.52 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate |
|---|---|
| PubChem CID | 8775883 |
| Molecular Formula | C18H30N2OS |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate |
| SMILES | COC[C@H](C)/N=C(\N)SCc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C18H30N2OS/c1-12-8-15(18(4,5)6)9-13(2)16(12)11-22-17(19)20-14(3)10-21-7/h8-9,14H,10-11H2,1-7H3,(H2,19,20)/t14-/m0/s1 |
| InChIKey | PHRGNCCSMXNQIN-AWEZNQCLSA-N |
| XLogP | 4.18 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|