C11H18ClN3S — CID 163452310
(2,4,6-trimethylphenyl)methyl N'-aminocarbamimidothioate;hydrochloride (PubChem CID 163452310) has the molecular formula C11H18ClN3S and a molecular weight of 259.81 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)methyl N'-aminocarbamimidothioate;hydrochloride.
| Compound Name | (2,4,6-trimethylphenyl)methyl N'-aminocarbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 163452310 |
| Molecular Formula | C11H18ClN3S |
| Molecular Weight | 259.81 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (2,4,6-trimethylphenyl)methyl N'-aminocarbamimidothioate;hydrochloride |
| SMILES | Cc1cc(C)c(CSC(N)=NN)c(C)c1.Cl |
| InChI | InChI=1S/C11H17N3S.ClH/c1-7-4-8(2)10(9(3)5-7)6-15-11(12)14-13;/h4-5H,6,13H2,1-3H3,(H2,12,14);1H |
| InChIKey | BHPGSKSDZKZJIP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.81 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|