C21H28N2S — CID 8776569
(4-tert-butyl-2,6-dimethylphenyl)methyl N'-(3-methylphenyl)carbamimidothioate (PubChem CID 8776569) has the molecular formula C21H28N2S and a molecular weight of 340.54 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl N'-(3-methylphenyl)carbamimidothioate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl N'-(3-methylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 8776569 |
| Molecular Formula | C21H28N2S |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl N'-(3-methylphenyl)carbamimidothioate |
| SMILES | Cc1cccc(/N=C(\N)SCc2c(C)cc(C(C)(C)C)cc2C)c1 |
| InChI | InChI=1S/C21H28N2S/c1-14-8-7-9-18(10-14)23-20(22)24-13-19-15(2)11-17(12-16(19)3)21(4,5)6/h7-12H,13H2,1-6H3,(H2,22,23) |
| InChIKey | ZAJJAFOUFYZARL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|