C16H26N2S — CID 4845278
(4-tert-butyl-2,6-dimethylphenyl)methyl N,N'-dimethylcarbamimidothioate (PubChem CID 4845278) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl N,N'-dimethylcarbamimidothioate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 4845278 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SCc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C16H26N2S/c1-11-8-13(16(3,4)5)9-12(2)14(11)10-19-15(17-6)18-7/h8-9H,10H2,1-7H3,(H,17,18) |
| InChIKey | HWTQWFXQPWYHNZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|