C23H30I2 — CID 21043173
5-tert-butyl-2-[(4-tert-butyl-2-iodo-6-methylphenyl)methyl]-1-iodo-3-methylbenzene (PubChem CID 21043173) has the molecular formula C23H30I2 and a molecular weight of 560.30 g/mol. Its IUPAC name is 5-tert-butyl-2-[(4-tert-butyl-2-iodo-6-methylphenyl)methyl]-1-iodo-3-methylbenzene.
| Compound Name | 5-tert-butyl-2-[(4-tert-butyl-2-iodo-6-methylphenyl)methyl]-1-iodo-3-methylbenzene |
|---|---|
| PubChem CID | 21043173 |
| Molecular Formula | C23H30I2 |
| Molecular Weight | 560.30 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | 5-tert-butyl-2-[(4-tert-butyl-2-iodo-6-methylphenyl)methyl]-1-iodo-3-methylbenzene |
| SMILES | Cc1cc(C(C)(C)C)cc(I)c1Cc1c(C)cc(C(C)(C)C)cc1I |
| InChI | InChI=1S/C23H30I2/c1-14-9-16(22(3,4)5)11-20(24)18(14)13-19-15(2)10-17(12-21(19)25)23(6,7)8/h9-12H,13H2,1-8H3 |
| InChIKey | SFYOAPIPSNHLKT-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.30 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|