C16H26S — CID 95461659
4-(4-tert-butyl-2,6-dimethylphenyl)butane-1-thiol (PubChem CID 95461659) has the molecular formula C16H26S and a molecular weight of 250.45 g/mol. Its IUPAC name is 4-(4-tert-butyl-2,6-dimethylphenyl)butane-1-thiol.
| Compound Name | 4-(4-tert-butyl-2,6-dimethylphenyl)butane-1-thiol |
|---|---|
| PubChem CID | 95461659 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-(4-tert-butyl-2,6-dimethylphenyl)butane-1-thiol |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CCCCS |
| InChI | InChI=1S/C16H26S/c1-12-10-14(16(3,4)5)11-13(2)15(12)8-6-7-9-17/h10-11,17H,6-9H2,1-5H3 |
| InChIKey | OXDXNMKLQWDARD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|