C15H25NS — CID 116831260
3-amino-3-(4-tert-butyl-2,6-dimethylphenyl)propane-1-thiol (PubChem CID 116831260) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is 3-amino-3-(4-tert-butyl-2,6-dimethylphenyl)propane-1-thiol.
| Compound Name | 3-amino-3-(4-tert-butyl-2,6-dimethylphenyl)propane-1-thiol |
|---|---|
| PubChem CID | 116831260 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-amino-3-(4-tert-butyl-2,6-dimethylphenyl)propane-1-thiol |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(N)CCS |
| InChI | InChI=1S/C15H25NS/c1-10-8-12(15(3,4)5)9-11(2)14(10)13(16)6-7-17/h8-9,13,17H,6-7,16H2,1-5H3 |
| InChIKey | LOBHISWVJBYOHP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|