C14H20F3N — CID 105024104
5,5,5-trifluoro-1-(2,4,6-trimethylphenyl)pentan-1-amine (PubChem CID 105024104) has the molecular formula C14H20F3N and a molecular weight of 259.31 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(2,4,6-trimethylphenyl)pentan-1-amine.
| Compound Name | 5,5,5-trifluoro-1-(2,4,6-trimethylphenyl)pentan-1-amine |
|---|---|
| PubChem CID | 105024104 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 5,5,5-trifluoro-1-(2,4,6-trimethylphenyl)pentan-1-amine |
| SMILES | Cc1cc(C)c(C(N)CCCC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C14H20F3N/c1-9-7-10(2)13(11(3)8-9)12(18)5-4-6-14(15,16)17/h7-8,12H,4-6,18H2,1-3H3 |
| InChIKey | ROSMQRSANVPSQA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |