C13H21F3N2 — CID 143077425
toluene;6,6,6-trifluorohexane-1,2-diamine (PubChem CID 143077425) has the molecular formula C13H21F3N2 and a molecular weight of 262.32 g/mol. Its IUPAC name is toluene;6,6,6-trifluorohexane-1,2-diamine.
| Compound Name | toluene;6,6,6-trifluorohexane-1,2-diamine |
|---|---|
| PubChem CID | 143077425 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | toluene;6,6,6-trifluorohexane-1,2-diamine |
| SMILES | Cc1ccccc1.NCC(N)CCCC(F)(F)F |
| InChI | InChI=1S/C7H8.C6H13F3N2/c1-7-5-3-2-4-6-7;7-6(8,9)3-1-2-5(11)4-10/h2-6H,1H3;5H,1-4,10-11H2 |
| InChIKey | FEEROILQNINQBU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |