C14H20F3N — CID 115516607
1-(3,5-dimethylphenyl)-6,6,6-trifluorohexan-2-amine (PubChem CID 115516607) has the molecular formula C14H20F3N and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-6,6,6-trifluorohexan-2-amine.
| Compound Name | 1-(3,5-dimethylphenyl)-6,6,6-trifluorohexan-2-amine |
|---|---|
| PubChem CID | 115516607 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-6,6,6-trifluorohexan-2-amine |
| SMILES | Cc1cc(C)cc(CC(N)CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3N/c1-10-6-11(2)8-12(7-10)9-13(18)4-3-5-14(15,16)17/h6-8,13H,3-5,9,18H2,1-2H3 |
| InChIKey | UEGYVYWJNWYHBS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |