C12H17F3N2O — CID 115517420
6,6,6-trifluoro-1-(6-methoxy-3-pyridinyl)hexan-2-amine (PubChem CID 115517420) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-(6-methoxy-3-pyridinyl)hexan-2-amine.
| Compound Name | 6,6,6-trifluoro-1-(6-methoxy-3-pyridinyl)hexan-2-amine |
|---|---|
| PubChem CID | 115517420 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 6,6,6-trifluoro-1-(6-methoxy-3-pyridinyl)hexan-2-amine |
| SMILES | COc1ccc(CC(N)CCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C12H17F3N2O/c1-18-11-5-4-9(8-17-11)7-10(16)3-2-6-12(13,14)15/h4-5,8,10H,2-3,6-7,16H2,1H3 |
| InChIKey | YXEPRQIWUKWBOE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |