C9H11F3N2O — CID 112693379
3,3,3-trifluoro-1-(6-methoxy-3-pyridinyl)propan-1-amine (PubChem CID 112693379) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-(6-methoxy-3-pyridinyl)propan-1-amine.
| Compound Name | 3,3,3-trifluoro-1-(6-methoxy-3-pyridinyl)propan-1-amine |
|---|---|
| PubChem CID | 112693379 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3,3,3-trifluoro-1-(6-methoxy-3-pyridinyl)propan-1-amine |
| SMILES | COc1ccc(C(N)CC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H11F3N2O/c1-15-8-3-2-6(5-14-8)7(13)4-9(10,11)12/h2-3,5,7H,4,13H2,1H3 |
| InChIKey | ZAIHRIRTFBQNGF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |