C9H15ClN2O2 — CID 170874858
3-amino-3-(6-methoxy-3-pyridinyl)propan-1-ol;hydrochloride (PubChem CID 170874858) has the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. Its IUPAC name is 3-amino-3-(6-methoxy-3-pyridinyl)propan-1-ol;hydrochloride.
| Compound Name | 3-amino-3-(6-methoxy-3-pyridinyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170874858 |
| Molecular Formula | C9H15ClN2O2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3-amino-3-(6-methoxy-3-pyridinyl)propan-1-ol;hydrochloride |
| SMILES | COc1ccc(C(N)CCO)cn1.Cl |
| InChI | InChI=1S/C9H14N2O2.ClH/c1-13-9-3-2-7(6-11-9)8(10)4-5-12;/h2-3,6,8,12H,4-5,10H2,1H3;1H |
| InChIKey | SPYQGWDWPOXPMF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |