C8H13N3O2 — CID 83828613
3-amino-3-(5-methoxypyrazin-2-yl)propan-1-ol (PubChem CID 83828613) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-amino-3-(5-methoxypyrazin-2-yl)propan-1-ol.
| Compound Name | 3-amino-3-(5-methoxypyrazin-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 83828613 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-amino-3-(5-methoxypyrazin-2-yl)propan-1-ol |
| SMILES | COc1cnc(C(N)CCO)cn1 |
| InChI | InChI=1S/C8H13N3O2/c1-13-8-5-10-7(4-11-8)6(9)2-3-12/h4-6,12H,2-3,9H2,1H3 |
| InChIKey | YOAAGWOGBQPTRI-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |