C14H17ClN2O2 — CID 170875135
3-amino-3-(6-phenoxy-3-pyridinyl)propan-1-ol;hydrochloride (PubChem CID 170875135) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is 3-amino-3-(6-phenoxy-3-pyridinyl)propan-1-ol;hydrochloride.
| Compound Name | 3-amino-3-(6-phenoxy-3-pyridinyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170875135 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3-amino-3-(6-phenoxy-3-pyridinyl)propan-1-ol;hydrochloride |
| SMILES | Cl.NC(CCO)c1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C14H16N2O2.ClH/c15-13(8-9-17)11-6-7-14(16-10-11)18-12-4-2-1-3-5-12;/h1-7,10,13,17H,8-9,15H2;1H |
| InChIKey | RTTAMNCCERPDRV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |