C14H22ClN — CID 171225337
(1S)-1-(2,4,6-trimethylphenyl)pent-4-en-1-amine;hydrochloride (PubChem CID 171225337) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is (1S)-1-(2,4,6-trimethylphenyl)pent-4-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2,4,6-trimethylphenyl)pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171225337 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | (1S)-1-(2,4,6-trimethylphenyl)pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@H](N)c1c(C)cc(C)cc1C.Cl |
| InChI | InChI=1S/C14H21N.ClH/c1-5-6-7-13(15)14-11(3)8-10(2)9-12(14)4;/h5,8-9,13H,1,6-7,15H2,2-4H3;1H/t13-;/m0./s1 |
| InChIKey | BGWMZYNSAJKNGD-ZOWNYOTGSA-N |
| XLogP | 4.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|