C18H30Cl2N2 — CID 171290601
1-[(1R)-1-(2,4,6-trimethylphenyl)pent-4-enyl]piperazine;dihydrochloride (PubChem CID 171290601) has the molecular formula C18H30Cl2N2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 1-[(1R)-1-(2,4,6-trimethylphenyl)pent-4-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2,4,6-trimethylphenyl)pent-4-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290601 |
| Molecular Formula | C18H30Cl2N2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(1R)-1-(2,4,6-trimethylphenyl)pent-4-enyl]piperazine;dihydrochloride |
| SMILES | C=CCC[C@H](c1c(C)cc(C)cc1C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H28N2.2ClH/c1-5-6-7-17(20-10-8-19-9-11-20)18-15(3)12-14(2)13-16(18)4;;/h5,12-13,17,19H,1,6-11H2,2-4H3;2*1H/t17-;;/m1../s1 |
| InChIKey | JEWSIASTMGYJLF-ZEECNFPPSA-N |
| XLogP | 4.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|