C15H24N2O — CID 171282669
1-[(1S)-1-(4,5-dimethylfuran-2-yl)pent-4-enyl]piperazine (PubChem CID 171282669) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[(1S)-1-(4,5-dimethylfuran-2-yl)pent-4-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(4,5-dimethylfuran-2-yl)pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171282669 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-[(1S)-1-(4,5-dimethylfuran-2-yl)pent-4-enyl]piperazine |
| SMILES | C=CCC[C@@H](c1cc(C)c(C)o1)N1CCNCC1 |
| InChI | InChI=1S/C15H24N2O/c1-4-5-6-14(17-9-7-16-8-10-17)15-11-12(2)13(3)18-15/h4,11,14,16H,1,5-10H2,2-3H3/t14-/m0/s1 |
| InChIKey | LMKJGPOKJQENBV-AWEZNQCLSA-N |
| XLogP | 2.81 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|