C13H24Cl2N2O — CID 171282638
1-[(1S)-1-(4,5-dimethylfuran-2-yl)propyl]piperazine;dihydrochloride (PubChem CID 171282638) has the molecular formula C13H24Cl2N2O and a molecular weight of 295.25 g/mol. Its IUPAC name is 1-[(1S)-1-(4,5-dimethylfuran-2-yl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(4,5-dimethylfuran-2-yl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171282638 |
| Molecular Formula | C13H24Cl2N2O |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-[(1S)-1-(4,5-dimethylfuran-2-yl)propyl]piperazine;dihydrochloride |
| SMILES | CC[C@@H](c1cc(C)c(C)o1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H22N2O.2ClH/c1-4-12(15-7-5-14-6-8-15)13-9-10(2)11(3)16-13;;/h9,12,14H,4-8H2,1-3H3;2*1H/t12-;;/m0../s1 |
| InChIKey | FOZKEEHSWVFCIJ-LTCKWSDVSA-N |
| XLogP | 3.10 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |