C13H24Cl2N2O — CID 171295119
1-[(1R)-1-(5-ethylfuran-2-yl)propyl]piperazine;dihydrochloride (PubChem CID 171295119) has the molecular formula C13H24Cl2N2O and a molecular weight of 295.25 g/mol. Its IUPAC name is 1-[(1R)-1-(5-ethylfuran-2-yl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(5-ethylfuran-2-yl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171295119 |
| Molecular Formula | C13H24Cl2N2O |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-[(1R)-1-(5-ethylfuran-2-yl)propyl]piperazine;dihydrochloride |
| SMILES | CCc1ccc([C@@H](CC)N2CCNCC2)o1.Cl.Cl |
| InChI | InChI=1S/C13H22N2O.2ClH/c1-3-11-5-6-13(16-11)12(4-2)15-9-7-14-8-10-15;;/h5-6,12,14H,3-4,7-10H2,1-2H3;2*1H/t12-;;/m1../s1 |
| InChIKey | FIQDYFIQGPWRCP-CURYUGHLSA-N |
| XLogP | 3.04 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |