C13H19BrN2S — CID 171285422
1-[(1R)-1-(4-bromothiophen-2-yl)pent-4-enyl]piperazine (PubChem CID 171285422) has the molecular formula C13H19BrN2S and a molecular weight of 315.28 g/mol. Its IUPAC name is 1-[(1R)-1-(4-bromothiophen-2-yl)pent-4-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(4-bromothiophen-2-yl)pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171285422 |
| Molecular Formula | C13H19BrN2S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-[(1R)-1-(4-bromothiophen-2-yl)pent-4-enyl]piperazine |
| SMILES | C=CCC[C@H](c1cc(Br)cs1)N1CCNCC1 |
| InChI | InChI=1S/C13H19BrN2S/c1-2-3-4-12(13-9-11(14)10-17-13)16-7-5-15-6-8-16/h2,9-10,12,15H,1,3-8H2/t12-/m1/s1 |
| InChIKey | KIFOYKWSVROBAR-GFCCVEGCSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|