C11H14BrF3N2S — CID 171303292
1-[(1R)-1-(4-bromothiophen-2-yl)-3,3,3-trifluoropropyl]piperazine (PubChem CID 171303292) has the molecular formula C11H14BrF3N2S and a molecular weight of 343.21 g/mol. Its IUPAC name is 1-[(1R)-1-(4-bromothiophen-2-yl)-3,3,3-trifluoropropyl]piperazine.
| Compound Name | 1-[(1R)-1-(4-bromothiophen-2-yl)-3,3,3-trifluoropropyl]piperazine |
|---|---|
| PubChem CID | 171303292 |
| Molecular Formula | C11H14BrF3N2S |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 1-[(1R)-1-(4-bromothiophen-2-yl)-3,3,3-trifluoropropyl]piperazine |
| SMILES | FC(F)(F)C[C@H](c1cc(Br)cs1)N1CCNCC1 |
| InChI | InChI=1S/C11H14BrF3N2S/c12-8-5-10(18-7-8)9(6-11(13,14)15)17-3-1-16-2-4-17/h5,7,9,16H,1-4,6H2/t9-/m1/s1 |
| InChIKey | BMYUTZCNHCVKIU-SECBINFHSA-N |
| XLogP | 3.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |