C23H28Cl2N2 — CID 171284729
1-[(1R)-1-anthracen-9-ylpent-4-enyl]piperazine;dihydrochloride (PubChem CID 171284729) has the molecular formula C23H28Cl2N2 and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-[(1R)-1-anthracen-9-ylpent-4-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-anthracen-9-ylpent-4-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171284729 |
| Molecular Formula | C23H28Cl2N2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-[(1R)-1-anthracen-9-ylpent-4-enyl]piperazine;dihydrochloride |
| SMILES | C=CCC[C@H](c1c2ccccc2cc2ccccc12)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C23H26N2.2ClH/c1-2-3-12-22(25-15-13-24-14-16-25)23-20-10-6-4-8-18(20)17-19-9-5-7-11-21(19)23;;/h2,4-11,17,22,24H,1,3,12-16H2;2*1H/t22-;;/m1../s1 |
| InChIKey | ZRXZFANXVVKBQP-GJICFQLNSA-N |
| XLogP | 5.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|