C21H28Cl2N2 — CID 171295763
1-[(1R)-1-(3-phenylphenyl)pent-4-enyl]piperazine;dihydrochloride (PubChem CID 171295763) has the molecular formula C21H28Cl2N2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 1-[(1R)-1-(3-phenylphenyl)pent-4-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-phenylphenyl)pent-4-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171295763 |
| Molecular Formula | C21H28Cl2N2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[(1R)-1-(3-phenylphenyl)pent-4-enyl]piperazine;dihydrochloride |
| SMILES | C=CCC[C@H](c1cccc(-c2ccccc2)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C21H26N2.2ClH/c1-2-3-12-21(23-15-13-22-14-16-23)20-11-7-10-19(17-20)18-8-5-4-6-9-18;;/h2,4-11,17,21-22H,1,3,12-16H2;2*1H/t21-;;/m1../s1 |
| InChIKey | AHWKMYBNYLVVOS-GHVWMZMZSA-N |
| XLogP | 5.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|