C22H32Cl2N2 — CID 171308362
1-[(1R)-1-(3-phenylphenyl)hexyl]piperazine;dihydrochloride (PubChem CID 171308362) has the molecular formula C22H32Cl2N2 and a molecular weight of 395.42 g/mol. Its IUPAC name is 1-[(1R)-1-(3-phenylphenyl)hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-phenylphenyl)hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171308362 |
| Molecular Formula | C22H32Cl2N2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[(1R)-1-(3-phenylphenyl)hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@H](c1cccc(-c2ccccc2)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C22H30N2.2ClH/c1-2-3-5-13-22(24-16-14-23-15-17-24)21-12-8-11-20(18-21)19-9-6-4-7-10-19;;/h4,6-12,18,22-23H,2-3,5,13-17H2,1H3;2*1H/t22-;;/m1../s1 |
| InChIKey | KXCJKDWVYAQDNQ-GJICFQLNSA-N |
| XLogP | 5.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|