C22H32Cl2N2O — CID 171308008
1-[(1R)-1-(4-phenoxyphenyl)hexyl]piperazine;dihydrochloride (PubChem CID 171308008) has the molecular formula C22H32Cl2N2O and a molecular weight of 411.42 g/mol. Its IUPAC name is 1-[(1R)-1-(4-phenoxyphenyl)hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(4-phenoxyphenyl)hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171308008 |
| Molecular Formula | C22H32Cl2N2O |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-[(1R)-1-(4-phenoxyphenyl)hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@H](c1ccc(Oc2ccccc2)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C22H30N2O.2ClH/c1-2-3-5-10-22(24-17-15-23-16-18-24)19-11-13-21(14-12-19)25-20-8-6-4-7-9-20;;/h4,6-9,11-14,22-23H,2-3,5,10,15-18H2,1H3;2*1H/t22-;;/m1../s1 |
| InChIKey | KCRIXHQLMXEFBT-GJICFQLNSA-N |
| XLogP | 5.85 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|