C22H30N2O — CID 171309305
1-[(1S)-1-(4-phenoxyphenyl)hexyl]piperazine (PubChem CID 171309305) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-[(1S)-1-(4-phenoxyphenyl)hexyl]piperazine.
| Compound Name | 1-[(1S)-1-(4-phenoxyphenyl)hexyl]piperazine |
|---|---|
| PubChem CID | 171309305 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 1-[(1S)-1-(4-phenoxyphenyl)hexyl]piperazine |
| SMILES | CCCCC[C@@H](c1ccc(Oc2ccccc2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C22H30N2O/c1-2-3-5-10-22(24-17-15-23-16-18-24)19-11-13-21(14-12-19)25-20-8-6-4-7-9-20/h4,6-9,11-14,22-23H,2-3,5,10,15-18H2,1H3/t22-/m0/s1 |
| InChIKey | JIZCZUIORYAHDR-QFIPXVFZSA-N |
| XLogP | 5.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|