C20H23F3N2O — CID 171165897
1-[(1S)-4,4,4-trifluoro-1-(4-phenoxyphenyl)butyl]piperazine (PubChem CID 171165897) has the molecular formula C20H23F3N2O and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(4-phenoxyphenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(4-phenoxyphenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171165897 |
| Molecular Formula | C20H23F3N2O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(4-phenoxyphenyl)butyl]piperazine |
| SMILES | FC(F)(F)CC[C@@H](c1ccc(Oc2ccccc2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C20H23F3N2O/c21-20(22,23)11-10-19(25-14-12-24-13-15-25)16-6-8-18(9-7-16)26-17-4-2-1-3-5-17/h1-9,19,24H,10-15H2/t19-/m0/s1 |
| InChIKey | ZZWXGDVHCQBMHR-IBGZPJMESA-N |
| XLogP | 4.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |