C18H22ClF3N2 — CID 171168796
1-[(1R)-4,4,4-trifluoro-1-naphthalen-2-ylbutyl]piperazine;hydrochloride (PubChem CID 171168796) has the molecular formula C18H22ClF3N2 and a molecular weight of 358.84 g/mol. Its IUPAC name is 1-[(1R)-4,4,4-trifluoro-1-naphthalen-2-ylbutyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-4,4,4-trifluoro-1-naphthalen-2-ylbutyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171168796 |
| Molecular Formula | C18H22ClF3N2 |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-[(1R)-4,4,4-trifluoro-1-naphthalen-2-ylbutyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)CC[C@H](c1ccc2ccccc2c1)N1CCNCC1 |
| InChI | InChI=1S/C18H21F3N2.ClH/c19-18(20,21)8-7-17(23-11-9-22-10-12-23)16-6-5-14-3-1-2-4-15(14)13-16;/h1-6,13,17,22H,7-12H2;1H/t17-;/m1./s1 |
| InChIKey | IMHSSUZORZUHGM-UNTBIKODSA-N |
| XLogP | 4.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |