C21H24ClF3N2 — CID 171172658
1-[(1R)-1-(9H-fluoren-2-yl)-4,4,4-trifluorobutyl]piperazine;hydrochloride (PubChem CID 171172658) has the molecular formula C21H24ClF3N2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 1-[(1R)-1-(9H-fluoren-2-yl)-4,4,4-trifluorobutyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(9H-fluoren-2-yl)-4,4,4-trifluorobutyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172658 |
| Molecular Formula | C21H24ClF3N2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-[(1R)-1-(9H-fluoren-2-yl)-4,4,4-trifluorobutyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)CC[C@H](c1ccc2c(c1)Cc1ccccc1-2)N1CCNCC1 |
| InChI | InChI=1S/C21H23F3N2.ClH/c22-21(23,24)8-7-20(26-11-9-25-10-12-26)16-5-6-19-17(14-16)13-15-3-1-2-4-18(15)19;/h1-6,14,20,25H,7-13H2;1H/t20-;/m1./s1 |
| InChIKey | KOIDAXRURLYUDL-VEIFNGETSA-N |
| XLogP | 4.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |