C23H30N2 — CID 171308299
1-[(1R)-1-(9H-fluoren-2-yl)hexyl]piperazine (PubChem CID 171308299) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-[(1R)-1-(9H-fluoren-2-yl)hexyl]piperazine.
| Compound Name | 1-[(1R)-1-(9H-fluoren-2-yl)hexyl]piperazine |
|---|---|
| PubChem CID | 171308299 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1-[(1R)-1-(9H-fluoren-2-yl)hexyl]piperazine |
| SMILES | CCCCC[C@H](c1ccc2c(c1)Cc1ccccc1-2)N1CCNCC1 |
| InChI | InChI=1S/C23H30N2/c1-2-3-4-9-23(25-14-12-24-13-15-25)19-10-11-22-20(17-19)16-18-7-5-6-8-21(18)22/h5-8,10-11,17,23-24H,2-4,9,12-16H2,1H3/t23-/m1/s1 |
| InChIKey | NOYBQFDJLAXIOD-HSZRJFAPSA-N |
| XLogP | 4.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|