C21H28N2O — CID 171282418
1-[(1S)-1-(2-ethoxynaphthalen-1-yl)pent-4-enyl]piperazine (PubChem CID 171282418) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[(1S)-1-(2-ethoxynaphthalen-1-yl)pent-4-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-ethoxynaphthalen-1-yl)pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171282418 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 1-[(1S)-1-(2-ethoxynaphthalen-1-yl)pent-4-enyl]piperazine |
| SMILES | C=CCC[C@@H](c1c(OCC)ccc2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C21H28N2O/c1-3-5-10-19(23-15-13-22-14-16-23)21-18-9-7-6-8-17(18)11-12-20(21)24-4-2/h3,6-9,11-12,19,22H,1,4-5,10,13-16H2,2H3/t19-/m0/s1 |
| InChIKey | BSGTTWORCSBAHC-IBGZPJMESA-N |
| XLogP | 4.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|