C22H34Cl2N2O — CID 171309582
1-[(1S)-1-(2-ethoxynaphthalen-1-yl)hexyl]piperazine;dihydrochloride (PubChem CID 171309582) has the molecular formula C22H34Cl2N2O and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[(1S)-1-(2-ethoxynaphthalen-1-yl)hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-ethoxynaphthalen-1-yl)hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171309582 |
| Molecular Formula | C22H34Cl2N2O |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[(1S)-1-(2-ethoxynaphthalen-1-yl)hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@@H](c1c(OCC)ccc2ccccc12)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C22H32N2O.2ClH/c1-3-5-6-11-20(24-16-14-23-15-17-24)22-19-10-8-7-9-18(19)12-13-21(22)25-4-2;;/h7-10,12-13,20,23H,3-6,11,14-17H2,1-2H3;2*1H/t20-;;/m0../s1 |
| InChIKey | DIVJPBAMYZVVGX-FJSYBICCSA-N |
| XLogP | 5.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|