C12H17ClFN — CID 171204371
(1R)-1-(3-fluoro-4-methylphenyl)pent-4-en-1-amine;hydrochloride (PubChem CID 171204371) has the molecular formula C12H17ClFN and a molecular weight of 229.73 g/mol. Its IUPAC name is (1R)-1-(3-fluoro-4-methylphenyl)pent-4-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(3-fluoro-4-methylphenyl)pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171204371 |
| Molecular Formula | C12H17ClFN |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (1R)-1-(3-fluoro-4-methylphenyl)pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@@H](N)c1ccc(C)c(F)c1.Cl |
| InChI | InChI=1S/C12H16FN.ClH/c1-3-4-5-12(14)10-7-6-9(2)11(13)8-10;/h3,6-8,12H,1,4-5,14H2,2H3;1H/t12-;/m1./s1 |
| InChIKey | BWUAYMIXGRFKQR-UTONKHPSSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|