C12H14ClF4NO — CID 171227921
(1S)-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pent-4-en-1-amine;hydrochloride (PubChem CID 171227921) has the molecular formula C12H14ClF4NO and a molecular weight of 299.70 g/mol. Its IUPAC name is (1S)-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pent-4-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171227921 |
| Molecular Formula | C12H14ClF4NO |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (1S)-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@H](N)c1ccc(OC(F)(F)F)c(F)c1.Cl |
| InChI | InChI=1S/C12H13F4NO.ClH/c1-2-3-4-10(17)8-5-6-11(9(13)7-8)18-12(14,15)16;/h2,5-7,10H,1,3-4,17H2;1H/t10-;/m0./s1 |
| InChIKey | KBJHEPCUICLKGC-PPHPATTJSA-N |
| XLogP | 4.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|