C12H15ClF3NO — CID 171207711
(1R)-1-[4-(trifluoromethoxy)phenyl]pent-4-en-1-amine;hydrochloride (PubChem CID 171207711) has the molecular formula C12H15ClF3NO and a molecular weight of 281.71 g/mol. Its IUPAC name is (1R)-1-[4-(trifluoromethoxy)phenyl]pent-4-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-[4-(trifluoromethoxy)phenyl]pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171207711 |
| Molecular Formula | C12H15ClF3NO |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (1R)-1-[4-(trifluoromethoxy)phenyl]pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@@H](N)c1ccc(OC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C12H14F3NO.ClH/c1-2-3-4-11(16)9-5-7-10(8-6-9)17-12(13,14)15;/h2,5-8,11H,1,3-4,16H2;1H/t11-;/m1./s1 |
| InChIKey | UGRFLPNQHQKSLP-RFVHGSKJSA-N |
| XLogP | 3.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|