C12H16FN — CID 171204036
(1R)-1-(2-fluoro-5-methylphenyl)pent-4-en-1-amine (PubChem CID 171204036) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is (1R)-1-(2-fluoro-5-methylphenyl)pent-4-en-1-amine.
| Compound Name | (1R)-1-(2-fluoro-5-methylphenyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 171204036 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (1R)-1-(2-fluoro-5-methylphenyl)pent-4-en-1-amine |
| SMILES | C=CCC[C@@H](N)c1cc(C)ccc1F |
| InChI | InChI=1S/C12H16FN/c1-3-4-5-12(14)10-8-9(2)6-7-11(10)13/h3,6-8,12H,1,4-5,14H2,2H3/t12-/m1/s1 |
| InChIKey | XVVQRVCSGDSGMI-GFCCVEGCSA-N |
| XLogP | 3.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|