C24H37N3 — CID 66808934
N'-[3-amino-3-(2,4,6-trimethylphenyl)propyl]-1-(2,4,6-trimethylphenyl)propane-1,3-diamine (PubChem CID 66808934) has the molecular formula C24H37N3 and a molecular weight of 367.58 g/mol. Its IUPAC name is N'-[3-amino-3-(2,4,6-trimethylphenyl)propyl]-1-(2,4,6-trimethylphenyl)propane-1,3-diamine.
| Compound Name | N'-[3-amino-3-(2,4,6-trimethylphenyl)propyl]-1-(2,4,6-trimethylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 66808934 |
| Molecular Formula | C24H37N3 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | N'-[3-amino-3-(2,4,6-trimethylphenyl)propyl]-1-(2,4,6-trimethylphenyl)propane-1,3-diamine |
| SMILES | Cc1cc(C)c(C(N)CCNCCC(N)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H37N3/c1-15-11-17(3)23(18(4)12-15)21(25)7-9-27-10-8-22(26)24-19(5)13-16(2)14-20(24)6/h11-14,21-22,27H,7-10,25-26H2,1-6H3 |
| InChIKey | NZIZLJXKFCTGNA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|