C12H21ClN2O — CID 171218216
4-[(1S)-1,4-diaminobutyl]-3,5-dimethylphenol;hydrochloride (PubChem CID 171218216) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is 4-[(1S)-1,4-diaminobutyl]-3,5-dimethylphenol;hydrochloride.
| Compound Name | 4-[(1S)-1,4-diaminobutyl]-3,5-dimethylphenol;hydrochloride |
|---|---|
| PubChem CID | 171218216 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-[(1S)-1,4-diaminobutyl]-3,5-dimethylphenol;hydrochloride |
| SMILES | Cc1cc(O)cc(C)c1[C@@H](N)CCCN.Cl |
| InChI | InChI=1S/C12H20N2O.ClH/c1-8-6-10(15)7-9(2)12(8)11(14)4-3-5-13;/h6-7,11,15H,3-5,13-14H2,1-2H3;1H/t11-;/m0./s1 |
| InChIKey | BODJVLBCWLZGDM-MERQFXBCSA-N |
| XLogP | 2.17 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |