C11H19ClN2O2 — CID 171199887
5-[(1R)-1,5-diaminopentyl]benzene-1,3-diol;hydrochloride (PubChem CID 171199887) has the molecular formula C11H19ClN2O2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 5-[(1R)-1,5-diaminopentyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 5-[(1R)-1,5-diaminopentyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 171199887 |
| Molecular Formula | C11H19ClN2O2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 5-[(1R)-1,5-diaminopentyl]benzene-1,3-diol;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H18N2O2.ClH/c12-4-2-1-3-11(13)8-5-9(14)7-10(15)6-8;/h5-7,11,14-15H,1-4,12-13H2;1H/t11-;/m1./s1 |
| InChIKey | DAZXKOAZUOUAQB-RFVHGSKJSA-N |
| XLogP | 1.65 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|