C11H16F2N2 — CID 171224073
(1S)-1-(3,5-difluorophenyl)pentane-1,5-diamine (PubChem CID 171224073) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (1S)-1-(3,5-difluorophenyl)pentane-1,5-diamine.
| Compound Name | (1S)-1-(3,5-difluorophenyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171224073 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | (1S)-1-(3,5-difluorophenyl)pentane-1,5-diamine |
| SMILES | NCCCC[C@H](N)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H16F2N2/c12-9-5-8(6-10(13)7-9)11(15)3-1-2-4-14/h5-7,11H,1-4,14-15H2/t11-/m0/s1 |
| InChIKey | DJSIGKWRXANNOY-NSHDSACASA-N |
| XLogP | 2.09 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|